C31H30F2O3Se — CID 86599534
methyl 4-[2-[[4-[(2,4-difluorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate (PubChem CID 86599534) has the molecular formula C31H30F2O3Se and a molecular weight of 567.53 g/mol. Its IUPAC name is methyl 4-[2-[[4-[(2,4-difluorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[[4-[(2,4-difluorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 86599534 |
| Molecular Formula | C31H30F2O3Se |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | methyl 4-[2-[[4-[(2,4-difluorophenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#C[Se]c2cc(OCc3ccc(F)cc3F)c3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C31H30F2O3Se/c1-30(2)13-14-31(3,4)28-25(30)17-24(18-27(28)36-19-22-10-11-23(32)16-26(22)33)37-15-12-20-6-8-21(9-7-20)29(34)35-5/h6-11,16-18H,13-14,19H2,1-5H3 |
| InChIKey | XXVVBFWPTFRQSN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|