C22H20O3 — CID 22323716
ethyl 4-[2-(6,6-dimethyl-4-oxo-5H-inden-2-yl)ethynyl]benzoate (PubChem CID 22323716) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 4-[2-(6,6-dimethyl-4-oxo-5H-inden-2-yl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(6,6-dimethyl-4-oxo-5H-inden-2-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 22323716 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 4-[2-(6,6-dimethyl-4-oxo-5H-inden-2-yl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#CC2=CC3=CC(C)(C)CC(=O)C3=C2)cc1 |
| InChI | InChI=1S/C22H20O3/c1-4-25-21(24)17-9-7-15(8-10-17)5-6-16-11-18-13-22(2,3)14-20(23)19(18)12-16/h7-13H,4,14H2,1-3H3 |
| InChIKey | SXWJJLNSLYNLEI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|