C17H9F5O2 — CID 45378561
ethyl 4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]benzoate (PubChem CID 45378561) has the molecular formula C17H9F5O2 and a molecular weight of 340.25 g/mol. Its IUPAC name is ethyl 4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]benzoate.
| Compound Name | ethyl 4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 45378561 |
| Molecular Formula | C17H9F5O2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | ethyl 4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H9F5O2/c1-2-24-17(23)10-6-3-9(4-7-10)5-8-11-12(18)14(20)16(22)15(21)13(11)19/h3-4,6-7H,2H2,1H3 |
| InChIKey | BPLWMYHEJQGWPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|