C19H15F3O2 — CID 67947952
ethyl 4-[2-[4-(2,2,2-trifluoroethyl)phenyl]ethynyl]benzoate (PubChem CID 67947952) has the molecular formula C19H15F3O2 and a molecular weight of 332.32 g/mol. Its IUPAC name is ethyl 4-[2-[4-(2,2,2-trifluoroethyl)phenyl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[4-(2,2,2-trifluoroethyl)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 67947952 |
| Molecular Formula | C19H15F3O2 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | ethyl 4-[2-[4-(2,2,2-trifluoroethyl)phenyl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc(CC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H15F3O2/c1-2-24-18(23)17-11-9-15(10-12-17)4-3-14-5-7-16(8-6-14)13-19(20,21)22/h5-12H,2,13H2,1H3 |
| InChIKey | QELCTYASENJXNS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|