C28H32O4 — CID 15391674
ethyl 4-[2-[(8R)-5,5-dimethyl-8-[(2S)-oxan-2-yl]oxy-7,8-dihydro-6H-naphthalen-2-yl]ethynyl]benzoate (PubChem CID 15391674) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is ethyl 4-[2-[(8R)-5,5-dimethyl-8-[(2S)-oxan-2-yl]oxy-7,8-dihydro-6H-naphthalen-2-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[(8R)-5,5-dimethyl-8-[(2S)-oxan-2-yl]oxy-7,8-dihydro-6H-naphthalen-2-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 15391674 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | ethyl 4-[2-[(8R)-5,5-dimethyl-8-[(2S)-oxan-2-yl]oxy-7,8-dihydro-6H-naphthalen-2-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)[C@H](O[C@H]2CCCCO2)CCC3(C)C)cc1 |
| InChI | InChI=1S/C28H32O4/c1-4-30-27(29)22-13-10-20(11-14-22)8-9-21-12-15-24-23(19-21)25(16-17-28(24,2)3)32-26-7-5-6-18-31-26/h10-15,19,25-26H,4-7,16-18H2,1-3H3/t25-,26+/m1/s1 |
| InChIKey | HQIQQICSMVWQLW-FTJBHMTQSA-N |
| XLogP | 5.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|