C31H29NO2 — CID 90899573
ethyl 4-[4,4-dimethyl-1-(6-methyl-3-pyridinyl)-3H-anthracen-2-yl]benzoate (PubChem CID 90899573) has the molecular formula C31H29NO2 and a molecular weight of 447.58 g/mol. Its IUPAC name is ethyl 4-[4,4-dimethyl-1-(6-methyl-3-pyridinyl)-3H-anthracen-2-yl]benzoate.
| Compound Name | ethyl 4-[4,4-dimethyl-1-(6-methyl-3-pyridinyl)-3H-anthracen-2-yl]benzoate |
|---|---|
| PubChem CID | 90899573 |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethyl 4-[4,4-dimethyl-1-(6-methyl-3-pyridinyl)-3H-anthracen-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2=C(c3ccc(C)nc3)c3cc4ccccc4cc3C(C)(C)C2)cc1 |
| InChI | InChI=1S/C31H29NO2/c1-5-34-30(33)22-14-12-21(13-15-22)27-18-31(3,4)28-17-24-9-7-6-8-23(24)16-26(28)29(27)25-11-10-20(2)32-19-25/h6-17,19H,5,18H2,1-4H3 |
| InChIKey | XTOSGCPUXKXEFD-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|