C34H36O2 — CID 54174114
ethyl 4-(3-benzyl-5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoate (PubChem CID 54174114) has the molecular formula C34H36O2 and a molecular weight of 476.66 g/mol. Its IUPAC name is ethyl 4-(3-benzyl-5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoate.
| Compound Name | ethyl 4-(3-benzyl-5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoate |
|---|---|
| PubChem CID | 54174114 |
| Molecular Formula | C34H36O2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | ethyl 4-(3-benzyl-5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc3cc4c(cc3cc2Cc2ccccc2)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C34H36O2/c1-6-36-32(35)25-14-12-24(13-15-25)29-20-27-22-31-30(33(2,3)16-17-34(31,4)5)21-26(27)19-28(29)18-23-10-8-7-9-11-23/h7-15,19-22H,6,16-18H2,1-5H3 |
| InChIKey | OXAZAOMVSPCAEB-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |