C33H40O4 — CID 66660890
ethyl 4-[4-(4-hydroxybutoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 66660890) has the molecular formula C33H40O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is ethyl 4-[4-(4-hydroxybutoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | ethyl 4-[4-(4-hydroxybutoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 66660890 |
| Molecular Formula | C33H40O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | ethyl 4-[4-(4-hydroxybutoxy)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCCO)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C33H40O4/c1-6-36-31(35)24-11-9-23(10-12-24)25-14-16-30(37-20-8-7-19-34)27(21-25)26-13-15-28-29(22-26)33(4,5)18-17-32(28,2)3/h9-16,21-22,34H,6-8,17-20H2,1-5H3 |
| InChIKey | NBCZRQOTMXSRIZ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|