C32H40O5Si2 — CID 171749634
ethyl 4-[4-(3-acetyloxypropoxy)-3-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)phenyl]benzoate (PubChem CID 171749634) has the molecular formula C32H40O5Si2 and a molecular weight of 560.84 g/mol. Its IUPAC name is ethyl 4-[4-(3-acetyloxypropoxy)-3-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)phenyl]benzoate.
| Compound Name | ethyl 4-[4-(3-acetyloxypropoxy)-3-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 171749634 |
| Molecular Formula | C32H40O5Si2 |
| Molecular Weight | 560.84 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | ethyl 4-[4-(3-acetyloxypropoxy)-3-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCOC(C)=O)c(-c3ccc4c(c3)[Si](C)(C)CC[Si]4(C)C)c2)cc1 |
| InChI | InChI=1S/C32H40O5Si2/c1-7-35-32(34)25-11-9-24(10-12-25)26-13-15-29(37-18-8-17-36-23(2)33)28(21-26)27-14-16-30-31(22-27)39(5,6)20-19-38(30,3)4/h9-16,21-22H,7-8,17-20H2,1-6H3 |
| InChIKey | HLSVLPOIFDHFCF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.84 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|