C33H41NO4 — CID 87099923
ethyl 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(4-oxobutoxy)phenyl]benzoate (PubChem CID 87099923) has the molecular formula C33H41NO4 and a molecular weight of 515.69 g/mol. Its IUPAC name is ethyl 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(4-oxobutoxy)phenyl]benzoate.
| Compound Name | ethyl 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(4-oxobutoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 87099923 |
| Molecular Formula | C33H41NO4 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | ethyl 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(4-oxobutoxy)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCC=O)c(-c3ccc(N(CC)CC)c(C(C)(C)C)c3)c2)cc1 |
| InChI | InChI=1S/C33H41NO4/c1-7-34(8-2)30-18-16-27(23-29(30)33(4,5)6)28-22-26(17-19-31(28)38-21-11-10-20-35)24-12-14-25(15-13-24)32(36)37-9-3/h12-20,22-23H,7-11,21H2,1-6H3 |
| InChIKey | BAHKAEYMIZKXBU-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|