C32H39NO4 — CID 91431535
3-hydroxypropyl 4-[3-[4-[acetyl(ethyl)amino]-3-tert-butylphenyl]phenyl]-3-ethylbenzoate (PubChem CID 91431535) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is 3-hydroxypropyl 4-[3-[4-[acetyl(ethyl)amino]-3-tert-butylphenyl]phenyl]-3-ethylbenzoate.
| Compound Name | 3-hydroxypropyl 4-[3-[4-[acetyl(ethyl)amino]-3-tert-butylphenyl]phenyl]-3-ethylbenzoate |
|---|---|
| PubChem CID | 91431535 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 3-hydroxypropyl 4-[3-[4-[acetyl(ethyl)amino]-3-tert-butylphenyl]phenyl]-3-ethylbenzoate |
| SMILES | CCc1cc(C(=O)OCCCO)ccc1-c1cccc(-c2ccc(N(CC)C(C)=O)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C32H39NO4/c1-7-23-19-27(31(36)37-18-10-17-34)13-15-28(23)26-12-9-11-24(20-26)25-14-16-30(33(8-2)22(3)35)29(21-25)32(4,5)6/h9,11-16,19-21,34H,7-8,10,17-18H2,1-6H3 |
| InChIKey | HHNNURCYONSQSX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|