C34H46N2O2 — CID 11699199
4-[4-[3-(tert-butylamino)propyl]-3-[3-tert-butyl-4-(diethylamino)phenyl]phenyl]benzoic acid (PubChem CID 11699199) has the molecular formula C34H46N2O2 and a molecular weight of 514.75 g/mol. Its IUPAC name is 4-[4-[3-(tert-butylamino)propyl]-3-[3-tert-butyl-4-(diethylamino)phenyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[3-(tert-butylamino)propyl]-3-[3-tert-butyl-4-(diethylamino)phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11699199 |
| Molecular Formula | C34H46N2O2 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 4-[4-[3-(tert-butylamino)propyl]-3-[3-tert-butyl-4-(diethylamino)phenyl]phenyl]benzoic acid |
| SMILES | CCN(CC)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2CCCNC(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C34H46N2O2/c1-9-36(10-2)31-20-19-28(23-30(31)33(3,4)5)29-22-27(24-13-16-26(17-14-24)32(37)38)18-15-25(29)12-11-21-35-34(6,7)8/h13-20,22-23,35H,9-12,21H2,1-8H3,(H,37,38) |
| InChIKey | DQROTMMXDYJZBA-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|