C31H39NO5 — CID 66672412
[4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate (PubChem CID 66672412) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is [4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 66672412 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | [4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCN(CCC)c1ccc(-c2cc(-c3ccc(OC(=O)O)cc3)ccc2OCCO)cc1C(C)(C)C |
| InChI | InChI=1S/C31H39NO5/c1-6-16-32(17-7-2)28-14-10-24(21-27(28)31(3,4)5)26-20-23(11-15-29(26)36-19-18-33)22-8-12-25(13-9-22)37-30(34)35/h8-15,20-21,33H,6-7,16-19H2,1-5H3,(H,34,35) |
| InChIKey | XUUNBDRUDQJRJB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|