C32H41NO4 — CID 11569657
4-[3-[4-(diethylamino)-3,5-di(propan-2-yl)phenyl]-4-(3-hydroxypropoxy)phenyl]benzoic acid (PubChem CID 11569657) has the molecular formula C32H41NO4 and a molecular weight of 503.68 g/mol. Its IUPAC name is 4-[3-[4-(diethylamino)-3,5-di(propan-2-yl)phenyl]-4-(3-hydroxypropoxy)phenyl]benzoic acid.
| Compound Name | 4-[3-[4-(diethylamino)-3,5-di(propan-2-yl)phenyl]-4-(3-hydroxypropoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 11569657 |
| Molecular Formula | C32H41NO4 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | 4-[3-[4-(diethylamino)-3,5-di(propan-2-yl)phenyl]-4-(3-hydroxypropoxy)phenyl]benzoic acid |
| SMILES | CCN(CC)c1c(C(C)C)cc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCCO)cc1C(C)C |
| InChI | InChI=1S/C32H41NO4/c1-7-33(8-2)31-27(21(3)4)19-26(20-28(31)22(5)6)29-18-25(14-15-30(29)37-17-9-16-34)23-10-12-24(13-11-23)32(35)36/h10-15,18-22,34H,7-9,16-17H2,1-6H3,(H,35,36) |
| InChIKey | DYGHHKYSPDSAKB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|