C25H31NO3 — CID 139681091
4-[3-cyano-4-(8-methyldecoxy)phenyl]benzoic acid (PubChem CID 139681091) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-[3-cyano-4-(8-methyldecoxy)phenyl]benzoic acid.
| Compound Name | 4-[3-cyano-4-(8-methyldecoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 139681091 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 4-[3-cyano-4-(8-methyldecoxy)phenyl]benzoic acid |
| SMILES | CCC(C)CCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1C#N |
| InChI | InChI=1S/C25H31NO3/c1-3-19(2)9-7-5-4-6-8-16-29-24-15-14-22(17-23(24)18-26)20-10-12-21(13-11-20)25(27)28/h10-15,17,19H,3-9,16H2,1-2H3,(H,27,28) |
| InChIKey | BJGUKFNPLAMJAG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|