C31H39NO4 — CID 11605566
4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid (PubChem CID 11605566) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is 4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid.
| Compound Name | 4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 11605566 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 4-[3-[3-tert-butyl-4-(dipropylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid |
| SMILES | CCCN(CCC)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCO)cc1C(C)(C)C |
| InChI | InChI=1S/C31H39NO4/c1-6-16-32(17-7-2)28-14-12-25(21-27(28)31(3,4)5)26-20-24(13-15-29(26)36-19-18-33)22-8-10-23(11-9-22)30(34)35/h8-15,20-21,33H,6-7,16-19H2,1-5H3,(H,34,35) |
| InChIKey | ZQBACMGXYVKHBZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |