C27H31NO4 — CID 11546547
4-[3-[4-(diethylamino)-3-ethylphenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid (PubChem CID 11546547) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-[3-[4-(diethylamino)-3-ethylphenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid.
| Compound Name | 4-[3-[4-(diethylamino)-3-ethylphenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 11546547 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 4-[3-[4-(diethylamino)-3-ethylphenyl]-4-(2-hydroxyethoxy)phenyl]benzoic acid |
| SMILES | CCc1cc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCO)ccc1N(CC)CC |
| InChI | InChI=1S/C27H31NO4/c1-4-19-17-23(11-13-25(19)28(5-2)6-3)24-18-22(12-14-26(24)32-16-15-29)20-7-9-21(10-8-20)27(30)31/h7-14,17-18,29H,4-6,15-16H2,1-3H3,(H,30,31) |
| InChIKey | MNICNAPNYMWMBN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |