C29H35NO5 — CID 66671789
[4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate (PubChem CID 66671789) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is [4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 66671789 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(2-hydroxyethoxy)phenyl]phenyl] hydrogen carbonate |
| SMILES | CCN(CC)c1ccc(-c2cc(-c3ccc(OC(=O)O)cc3)ccc2OCCO)cc1C(C)(C)C |
| InChI | InChI=1S/C29H35NO5/c1-6-30(7-2)26-14-10-22(19-25(26)29(3,4)5)24-18-21(11-15-27(24)34-17-16-31)20-8-12-23(13-9-20)35-28(32)33/h8-15,18-19,31H,6-7,16-17H2,1-5H3,(H,32,33) |
| InChIKey | QJXIZINQTDBKGY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|