C19H23NO3 — CID 167031138
[4-[4-(dipropylamino)phenyl]phenyl] hydrogen carbonate (PubChem CID 167031138) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is [4-[4-(dipropylamino)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[4-(dipropylamino)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 167031138 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [4-[4-(dipropylamino)phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCN(CCC)c1ccc(-c2ccc(OC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-3-13-20(14-4-2)17-9-5-15(6-10-17)16-7-11-18(12-8-16)23-19(21)22/h5-12H,3-4,13-14H2,1-2H3,(H,21,22) |
| InChIKey | XRRIPMGUSMDZEI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|