About [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane
[4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane (PubChem CID 91153786) has the molecular formula C16H27NO4
and a molecular weight of 297.40 g/mol. Its IUPAC name is [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane.
Molecular Properties
| Compound Name | [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane |
| PubChem CID | 91153786 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane |
| SMILES | CC.COCCN(CCOC)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C14H21NO4.C2H6/c1-12(16)19-14-6-4-13(5-7-14)15(8-10-17-2)9-11-18-3;1-2/h4-7H,8-11H2,1-3H3;1-2H3 |
| InChIKey | JEBDNTBSORNOJW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane?
The IUPAC name of [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane (CID 91153786) is [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane.
What is the SMILES notation for [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane?
The canonical SMILES for [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane is CC.COCCN(CCOC)c1ccc(OC(C)=O)cc1.
What is the InChIKey of [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane?
The InChIKey is JEBDNTBSORNOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4.C2H6/c1-12(16)19-14-6-4-13(5-7-14)15(8-10-17-2)9-11-18-3;1-2/h4-7H,8-11H2,1-3H3;1-2H3.
What are the key properties of [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane?
[4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane has a molecular weight of 297.40 g/mol, XLogP of 2.74, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[bis(2-methoxyethyl)amino]phenyl] acetate;ethane is sourced from PubChem (CID 91153786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).