C26H40N2O5 — CID 118894030
1,1-bis[4-[bis(2-methoxyethyl)amino]phenyl]ethanol (PubChem CID 118894030) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1,1-bis[4-[bis(2-methoxyethyl)amino]phenyl]ethanol.
| Compound Name | 1,1-bis[4-[bis(2-methoxyethyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 118894030 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | 1,1-bis[4-[bis(2-methoxyethyl)amino]phenyl]ethanol |
| SMILES | COCCN(CCOC)c1ccc(C(C)(O)c2ccc(N(CCOC)CCOC)cc2)cc1 |
| InChI | InChI=1S/C26H40N2O5/c1-26(29,22-6-10-24(11-7-22)27(14-18-30-2)15-19-31-3)23-8-12-25(13-9-23)28(16-20-32-4)17-21-33-5/h6-13,29H,14-21H2,1-5H3 |
| InChIKey | AWGJIRFDFQTXCT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|