C14H24N2O2 — CID 55189419
4-[(1R)-1-aminoethyl]-N,N-bis(2-methoxyethyl)aniline (PubChem CID 55189419) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-[(1R)-1-aminoethyl]-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 4-[(1R)-1-aminoethyl]-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 55189419 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4-[(1R)-1-aminoethyl]-N,N-bis(2-methoxyethyl)aniline |
| SMILES | COCCN(CCOC)c1ccc([C@@H](C)N)cc1 |
| InChI | InChI=1S/C14H24N2O2/c1-12(15)13-4-6-14(7-5-13)16(8-10-17-2)9-11-18-3/h4-7,12H,8-11,15H2,1-3H3/t12-/m1/s1 |
| InChIKey | XVMHFBUOQUGWAX-GFCCVEGCSA-N |
| XLogP | 1.81 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|