C27H40N2O3 — CID 174404931
2,4-bis[4-[ethyl(2-methoxyethyl)amino]phenyl]pentan-3-one (PubChem CID 174404931) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 2,4-bis[4-[ethyl(2-methoxyethyl)amino]phenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-[ethyl(2-methoxyethyl)amino]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 174404931 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 2,4-bis[4-[ethyl(2-methoxyethyl)amino]phenyl]pentan-3-one |
| SMILES | CCN(CCOC)c1ccc(C(C)C(=O)C(C)c2ccc(N(CC)CCOC)cc2)cc1 |
| InChI | InChI=1S/C27H40N2O3/c1-7-28(17-19-31-5)25-13-9-23(10-14-25)21(3)27(30)22(4)24-11-15-26(16-12-24)29(8-2)18-20-32-6/h9-16,21-22H,7-8,17-20H2,1-6H3 |
| InChIKey | AIUWGFFAWKMEDB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|