C15H26N2O2 — CID 54984969
4-(1-aminoethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)aniline (PubChem CID 54984969) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-(1-aminoethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)aniline.
| Compound Name | 4-(1-aminoethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)aniline |
|---|---|
| PubChem CID | 54984969 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-(1-aminoethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)aniline |
| SMILES | COCCCN(CCOC)c1ccc(C(C)N)cc1 |
| InChI | InChI=1S/C15H26N2O2/c1-13(16)14-5-7-15(8-6-14)17(10-12-19-3)9-4-11-18-2/h5-8,13H,4,9-12,16H2,1-3H3 |
| InChIKey | FRNQZDFYKACSCL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|