C39H55NO5Si — CID 131728358
ethyl 4-[4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-[3-tert-butyl-4-(3-oxobutylamino)phenyl]phenyl]benzoate (PubChem CID 131728358) has the molecular formula C39H55NO5Si and a molecular weight of 645.96 g/mol. Its IUPAC name is ethyl 4-[4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-[3-tert-butyl-4-(3-oxobutylamino)phenyl]phenyl]benzoate.
| Compound Name | ethyl 4-[4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-[3-tert-butyl-4-(3-oxobutylamino)phenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 131728358 |
| Molecular Formula | C39H55NO5Si |
| Molecular Weight | 645.96 g/mol |
| Exact Mass | 645.38 |
| IUPAC Name | ethyl 4-[4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-[3-tert-butyl-4-(3-oxobutylamino)phenyl]phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCCO[Si](C)(C)C(C)(C)C)c(-c3ccc(NCCC(C)=O)c(C(C)(C)C)c3)c2)cc1 |
| InChI | InChI=1S/C39H55NO5Si/c1-11-43-37(42)30-16-14-29(15-17-30)31-19-21-36(44-24-12-13-25-45-46(9,10)39(6,7)8)33(26-31)32-18-20-35(40-23-22-28(2)41)34(27-32)38(3,4)5/h14-21,26-27,40H,11-13,22-25H2,1-10H3 |
| InChIKey | OFXLNDNUQAGTTJ-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.96 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|