C23H31BrO4Si — CID 141144653
4-[3-bromo-4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]phenyl]benzoic acid (PubChem CID 141144653) has the molecular formula C23H31BrO4Si and a molecular weight of 479.49 g/mol. Its IUPAC name is 4-[3-bromo-4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]phenyl]benzoic acid.
| Compound Name | 4-[3-bromo-4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 141144653 |
| Molecular Formula | C23H31BrO4Si |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-[3-bromo-4-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]phenyl]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1Br |
| InChI | InChI=1S/C23H31BrO4Si/c1-23(2,3)29(4,5)28-15-7-6-14-27-21-13-12-19(16-20(21)24)17-8-10-18(11-9-17)22(25)26/h8-13,16H,6-7,14-15H2,1-5H3,(H,25,26) |
| InChIKey | UNKOCSSRUXEFRH-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|