C36H47NO3 — CID 11376167
ethyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 11376167) has the molecular formula C36H47NO3 and a molecular weight of 541.78 g/mol. Its IUPAC name is ethyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | ethyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 11376167 |
| Molecular Formula | C36H47NO3 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | ethyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCCNC(C)C)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C36H47NO3/c1-8-39-34(38)27-13-11-26(12-14-27)28-16-18-33(40-22-10-9-21-37-25(2)3)30(23-28)29-15-17-31-32(24-29)36(6,7)20-19-35(31,4)5/h11-18,23-25,37H,8-10,19-22H2,1-7H3 |
| InChIKey | YMTLPWLXPVXARS-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|