C34H42FNO4 — CID 69130328
[2-fluoro-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate (PubChem CID 69130328) has the molecular formula C34H42FNO4 and a molecular weight of 547.71 g/mol. Its IUPAC name is [2-fluoro-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-fluoro-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 69130328 |
| Molecular Formula | C34H42FNO4 |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | [2-fluoro-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]phenyl] hydrogen carbonate |
| SMILES | CC(C)NCCCCOc1ccc(-c2ccc(OC(=O)O)c(F)c2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H42FNO4/c1-22(2)36-17-7-8-18-39-30-13-10-23(24-11-14-31(29(35)21-24)40-32(37)38)19-26(30)25-9-12-27-28(20-25)34(5,6)16-15-33(27,3)4/h9-14,19-22,36H,7-8,15-18H2,1-6H3,(H,37,38) |
| InChIKey | DLZZYPVXWHRMMB-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|