C40H53NO8 — CID 11204655
[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 11204655) has the molecular formula C40H53NO8 and a molecular weight of 675.86 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 11204655 |
| Molecular Formula | C40H53NO8 |
| Molecular Weight | 675.86 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CC(C)NCCCCOc1ccc(-c2ccc(C(=O)OC[C@H]3OC(O)[C@H](O)[C@@H](O)[C@@H]3O)cc2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C40H53NO8/c1-24(2)41-19-7-8-20-47-32-16-14-27(21-29(32)28-13-15-30-31(22-28)40(5,6)18-17-39(30,3)4)25-9-11-26(12-10-25)37(45)48-23-33-34(42)35(43)36(44)38(46)49-33/h9-16,21-22,24,33-36,38,41-44,46H,7-8,17-20,23H2,1-6H3/t33-,34-,35+,36-,38?/m1/s1 |
| InChIKey | RFULVMTVTCZEKS-GAVKJZHTSA-N |
| XLogP | 5.48 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|