C36H48N2O2 — CID 66857823
3-ethyl-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzamide (PubChem CID 66857823) has the molecular formula C36H48N2O2 and a molecular weight of 540.79 g/mol. Its IUPAC name is 3-ethyl-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzamide.
| Compound Name | 3-ethyl-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 66857823 |
| Molecular Formula | C36H48N2O2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | 3-ethyl-4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzamide |
| SMILES | CCc1cc(C(N)=O)ccc1-c1ccc(OCCCCNC(C)C)c(-c2ccc3c(c2)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C36H48N2O2/c1-8-25-21-28(34(37)39)11-14-29(25)26-13-16-33(40-20-10-9-19-38-24(2)3)30(22-26)27-12-15-31-32(23-27)36(6,7)18-17-35(31,4)5/h11-16,21-24,38H,8-10,17-20H2,1-7H3,(H2,37,39) |
| InChIKey | SSRVRAATQMHZQE-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|