C37H49NO5 — CID 11353776
2,3-dihydroxypropyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 11353776) has the molecular formula C37H49NO5 and a molecular weight of 587.80 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | 2,3-dihydroxypropyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 11353776 |
| Molecular Formula | C37H49NO5 |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 2,3-dihydroxypropyl 4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CC(C)NCCCCOc1ccc(-c2ccc(C(=O)OCC(O)CO)cc2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C37H49NO5/c1-25(2)38-19-7-8-20-42-34-16-14-28(26-9-11-27(12-10-26)35(41)43-24-30(40)23-39)21-31(34)29-13-15-32-33(22-29)37(5,6)18-17-36(32,3)4/h9-16,21-22,25,30,38-40H,7-8,17-20,23-24H2,1-6H3 |
| InChIKey | KEJCWWCIMXSASE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|