C29H31F3O3 — CID 54363444
ethyl 4-[5,5,8,8-tetramethyl-4-(2,2,2-trifluoro-1-hydroxyethyl)-6,7-dihydroanthracen-2-yl]benzoate (PubChem CID 54363444) has the molecular formula C29H31F3O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is ethyl 4-[5,5,8,8-tetramethyl-4-(2,2,2-trifluoro-1-hydroxyethyl)-6,7-dihydroanthracen-2-yl]benzoate.
| Compound Name | ethyl 4-[5,5,8,8-tetramethyl-4-(2,2,2-trifluoro-1-hydroxyethyl)-6,7-dihydroanthracen-2-yl]benzoate |
|---|---|
| PubChem CID | 54363444 |
| Molecular Formula | C29H31F3O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | ethyl 4-[5,5,8,8-tetramethyl-4-(2,2,2-trifluoro-1-hydroxyethyl)-6,7-dihydroanthracen-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc(C(O)C(F)(F)F)c3cc4c(cc3c2)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C29H31F3O3/c1-6-35-26(34)18-9-7-17(8-10-18)19-13-20-15-23-24(28(4,5)12-11-27(23,2)3)16-21(20)22(14-19)25(33)29(30,31)32/h7-10,13-16,25,33H,6,11-12H2,1-5H3 |
| InChIKey | UOCIQQXHXGQLTF-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |