C26H28O2 — CID 57279387
4-(4,5,5,8,8-pentamethyl-6,7-dihydroanthracen-2-yl)benzoic acid (PubChem CID 57279387) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-(4,5,5,8,8-pentamethyl-6,7-dihydroanthracen-2-yl)benzoic acid.
| Compound Name | 4-(4,5,5,8,8-pentamethyl-6,7-dihydroanthracen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 57279387 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 4-(4,5,5,8,8-pentamethyl-6,7-dihydroanthracen-2-yl)benzoic acid |
| SMILES | Cc1cc(-c2ccc(C(=O)O)cc2)cc2cc3c(cc12)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C26H28O2/c1-16-12-19(17-6-8-18(9-7-17)24(27)28)13-20-14-22-23(15-21(16)20)26(4,5)11-10-25(22,2)3/h6-9,12-15H,10-11H2,1-5H3,(H,27,28) |
| InChIKey | IUZIMLUAFBWAJJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |