C24H19N3O2 — CID 102197724
ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate (PubChem CID 102197724) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate.
| Compound Name | ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate |
|---|---|
| PubChem CID | 102197724 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C24H19N3O2/c1-2-29-24(28)18-11-9-17(10-12-18)19-15-22(20-7-3-5-13-25-20)27-23(16-19)21-8-4-6-14-26-21/h3-16H,2H2,1H3 |
| InChIKey | YTNCQXZFEYRBPU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |