ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate

C24H19N3O2 — CID 102197724

IUPACethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate
SMILESCCOC(=O)c1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1
InChIInChI=1S/C24H19N3O2/c1-2-29-24(28)18-11-9-17(10-12-18)19-15-22(20-7-3-5-13-25-20)27-23(16-19)21-8-4-6-14-26-21/h3-16H,2H2,1H3
InChIKeyYTNCQXZFEYRBPU-UHFFFAOYSA-N
MW381.44 g/mol
LogP5.05
Rot. Bonds5

About ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate

ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate (PubChem CID 102197724) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate.

Molecular Properties

Compound Nameethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate
PubChem CID102197724
Molecular FormulaC24H19N3O2
Molecular Weight381.44 g/mol
Exact Mass381.15
IUPAC Nameethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate
SMILESCCOC(=O)c1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1
InChIInChI=1S/C24H19N3O2/c1-2-29-24(28)18-11-9-17(10-12-18)19-15-22(20-7-3-5-13-25-20)27-23(16-19)21-8-4-6-14-26-21/h3-16H,2H2,1H3
InChIKeyYTNCQXZFEYRBPU-UHFFFAOYSA-N
XLogP5.05
TPSA64.97 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500381.44
LogP ≤ 55.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate?
The IUPAC name of ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate (CID 102197724) is ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate.
What is the SMILES notation for ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate?
The canonical SMILES for ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate is CCOC(=O)c1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1.
What is the InChIKey of ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate?
The InChIKey is YTNCQXZFEYRBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O2/c1-2-29-24(28)18-11-9-17(10-12-18)19-15-22(20-7-3-5-13-25-20)27-23(16-19)21-8-4-6-14-26-21/h3-16H,2H2,1H3.
What are the key properties of ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate?
ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate has a molecular weight of 381.44 g/mol, XLogP of 5.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate is sourced from PubChem (CID 102197724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).