C57H44N6O6 — CID 136864019
ethyl 4-[10,20-bis(4-ethoxycarbonylphenyl)-15-(2-pyridin-2-yl-4-pyridinyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136864019) has the molecular formula C57H44N6O6 and a molecular weight of 909.01 g/mol. Its IUPAC name is ethyl 4-[10,20-bis(4-ethoxycarbonylphenyl)-15-(2-pyridin-2-yl-4-pyridinyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 4-[10,20-bis(4-ethoxycarbonylphenyl)-15-(2-pyridin-2-yl-4-pyridinyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136864019 |
| Molecular Formula | C57H44N6O6 |
| Molecular Weight | 909.01 g/mol |
| Exact Mass | 908.33 |
| IUPAC Name | ethyl 4-[10,20-bis(4-ethoxycarbonylphenyl)-15-(2-pyridin-2-yl-4-pyridinyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OCC)cc4)c4ccc([nH]4)c(-c4ccnc(-c5ccccn5)c4)c4nc(c(-c5ccc(C(=O)OCC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C57H44N6O6/c1-4-67-55(64)37-16-10-34(11-17-37)51-42-22-24-44(60-42)52(35-12-18-38(19-13-35)56(65)68-5-2)46-26-28-48(62-46)54(40-30-32-59-50(33-40)41-9-7-8-31-58-41)49-29-27-47(63-49)53(45-25-23-43(51)61-45)36-14-20-39(21-15-36)57(66)69-6-3/h7-33,60,63H,4-6H2,1-3H3/b51-42-,51-43-,52-44-,52-46-,53-45-,53-47-,54-48-,54-49- |
| InChIKey | KMHLRPKJRPQMIM-QZRQTBHASA-N |
| XLogP | 12.31 |
| TPSA | 162.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.01 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|