C30H28O4 — CID 69073874
4-[3-hydroxy-3-[5-[4-(methoxymethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]prop-1-ynyl]benzoic acid (PubChem CID 69073874) has the molecular formula C30H28O4 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-[3-hydroxy-3-[5-[4-(methoxymethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]prop-1-ynyl]benzoic acid.
| Compound Name | 4-[3-hydroxy-3-[5-[4-(methoxymethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]prop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 69073874 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 4-[3-hydroxy-3-[5-[4-(methoxymethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]prop-1-ynyl]benzoic acid |
| SMILES | COCc1ccc(C2=CCC(C)(C)c3cc(C(O)C#Cc4ccc(C(=O)O)cc4)ccc32)cc1 |
| InChI | InChI=1S/C30H28O4/c1-30(2)17-16-25(22-9-6-21(7-10-22)19-34-3)26-14-13-24(18-27(26)30)28(31)15-8-20-4-11-23(12-5-20)29(32)33/h4-7,9-14,16,18,28,31H,17,19H2,1-3H3,(H,32,33) |
| InChIKey | GBALZZRJKBJJRQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|