C34H40N2O3 — CID 10052538
4-[3-[4-[[4-(dimethylamino)phenyl]methyl-methylamino]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid (PubChem CID 10052538) has the molecular formula C34H40N2O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 4-[3-[4-[[4-(dimethylamino)phenyl]methyl-methylamino]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid.
| Compound Name | 4-[3-[4-[[4-(dimethylamino)phenyl]methyl-methylamino]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 10052538 |
| Molecular Formula | C34H40N2O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 4-[3-[4-[[4-(dimethylamino)phenyl]methyl-methylamino]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid |
| SMILES | CN(C)c1ccc(CN(C)c2cc(C(O)C#Cc3ccc(C(=O)O)cc3)cc3c2C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C34H40N2O3/c1-33(2)18-19-34(3,4)31-28(33)20-26(30(37)17-12-23-8-13-25(14-9-23)32(38)39)21-29(31)36(7)22-24-10-15-27(16-11-24)35(5)6/h8-11,13-16,20-21,30,37H,18-19,22H2,1-7H3,(H,38,39) |
| InChIKey | MHUFKVSDNYVZND-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|