C28H34O5 — CID 11751309
4-[(3R)-3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid (PubChem CID 11751309) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is 4-[(3R)-3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid.
| Compound Name | 4-[(3R)-3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 11751309 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 4-[(3R)-3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]benzoic acid |
| SMILES | CCOCCOc1cc([C@@H](O)C#Cc2ccc(C(=O)O)cc2)cc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H34O5/c1-6-32-15-16-33-24-18-21(17-22-25(24)28(4,5)14-13-27(22,2)3)23(29)12-9-19-7-10-20(11-8-19)26(30)31/h7-8,10-11,17-18,23,29H,6,13-16H2,1-5H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | PUTQZOMYROSUPH-QHCPKHFHSA-N |
| XLogP | 5.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|