C24H24O5S — CID 11304803
4-[3-hydroxy-3-[8-(2-methoxyethoxy)-4,4-dimethylthiochromen-6-yl]prop-1-ynyl]benzoic acid (PubChem CID 11304803) has the molecular formula C24H24O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 4-[3-hydroxy-3-[8-(2-methoxyethoxy)-4,4-dimethylthiochromen-6-yl]prop-1-ynyl]benzoic acid.
| Compound Name | 4-[3-hydroxy-3-[8-(2-methoxyethoxy)-4,4-dimethylthiochromen-6-yl]prop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 11304803 |
| Molecular Formula | C24H24O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-[3-hydroxy-3-[8-(2-methoxyethoxy)-4,4-dimethylthiochromen-6-yl]prop-1-ynyl]benzoic acid |
| SMILES | COCCOc1cc(C(O)C#Cc2ccc(C(=O)O)cc2)cc2c1SC=CC2(C)C |
| InChI | InChI=1S/C24H24O5S/c1-24(2)10-13-30-22-19(24)14-18(15-21(22)29-12-11-28-3)20(25)9-6-16-4-7-17(8-5-16)23(26)27/h4-5,7-8,10,13-15,20,25H,11-12H2,1-3H3,(H,26,27) |
| InChIKey | XLVYWWXUPIWOAP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|