C27H34O4 — CID 22619461
methyl 4-[3-(3-tert-butyl-4-hexoxyphenyl)-3-hydroxyprop-1-ynyl]benzoate (PubChem CID 22619461) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 4-[3-(3-tert-butyl-4-hexoxyphenyl)-3-hydroxyprop-1-ynyl]benzoate.
| Compound Name | methyl 4-[3-(3-tert-butyl-4-hexoxyphenyl)-3-hydroxyprop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 22619461 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl 4-[3-(3-tert-butyl-4-hexoxyphenyl)-3-hydroxyprop-1-ynyl]benzoate |
| SMILES | CCCCCCOc1ccc(C(O)C#Cc2ccc(C(=O)OC)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C27H34O4/c1-6-7-8-9-18-31-25-17-15-22(19-23(25)27(2,3)4)24(28)16-12-20-10-13-21(14-11-20)26(29)30-5/h10-11,13-15,17,19,24,28H,6-9,18H2,1-5H3 |
| InChIKey | WRAZSPXEOSFPOH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|