C26H32O5S — CID 11305625
5-[3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]thiophene-3-carboxylic acid (PubChem CID 11305625) has the molecular formula C26H32O5S and a molecular weight of 456.60 g/mol. Its IUPAC name is 5-[3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 11305625 |
| Molecular Formula | C26H32O5S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 5-[3-[4-(2-ethoxyethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]thiophene-3-carboxylic acid |
| SMILES | CCOCCOc1cc(C(O)C#Cc2cc(C(=O)O)cs2)cc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H32O5S/c1-6-30-11-12-31-22-15-17(14-20-23(22)26(4,5)10-9-25(20,2)3)21(27)8-7-19-13-18(16-32-19)24(28)29/h13-16,21,27H,6,9-12H2,1-5H3,(H,28,29) |
| InChIKey | NTQMMIVAPRKAPE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|