C35H42N2O2S — CID 69292574
4-[3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-ethylbenzamide (PubChem CID 69292574) has the molecular formula C35H42N2O2S and a molecular weight of 554.80 g/mol. Its IUPAC name is 4-[3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-ethylbenzamide.
| Compound Name | 4-[3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 69292574 |
| Molecular Formula | C35H42N2O2S |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 4-[3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-hydroxyprop-1-ynyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(C#CC(O)c2cc(SCc3ccc(N(C)C)cc3)c3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C35H42N2O2S/c1-8-36-33(39)26-14-9-24(10-15-26)13-18-30(38)27-21-29-32(35(4,5)20-19-34(29,2)3)31(22-27)40-23-25-11-16-28(17-12-25)37(6)7/h9-12,14-17,21-22,30,38H,8,19-20,23H2,1-7H3,(H,36,39) |
| InChIKey | WNITZBQMABTKBV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|