C30H27NO3Se — CID 10075631
4-[2-[[5-[4-(acetamidomethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid (PubChem CID 10075631) has the molecular formula C30H27NO3Se and a molecular weight of 528.51 g/mol. Its IUPAC name is 4-[2-[[5-[4-(acetamidomethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[[5-[4-(acetamidomethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 10075631 |
| Molecular Formula | C30H27NO3Se |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 4-[2-[[5-[4-(acetamidomethyl)phenyl]-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid |
| SMILES | CC(=O)NCc1ccc(C2=CCC(C)(C)c3cc([Se]C#Cc4ccc(C(=O)O)cc4)ccc32)cc1 |
| InChI | InChI=1S/C30H27NO3Se/c1-20(32)31-19-22-6-8-23(9-7-22)26-14-16-30(2,3)28-18-25(12-13-27(26)28)35-17-15-21-4-10-24(11-5-21)29(33)34/h4-14,18H,16,19H2,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | AJKWSXMQRWSBLV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|