C31H32O2Se — CID 10346430
(E)-3-[4-[[5-(4-tert-butylphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]phenyl]prop-2-enoic acid (PubChem CID 10346430) has the molecular formula C31H32O2Se and a molecular weight of 515.56 g/mol. Its IUPAC name is (E)-3-[4-[[5-(4-tert-butylphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[5-(4-tert-butylphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10346430 |
| Molecular Formula | C31H32O2Se |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (E)-3-[4-[[5-(4-tert-butylphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1ccc(C2=CCC(C)(C)c3cc([Se]c4ccc(/C=C/C(=O)O)cc4)ccc32)cc1 |
| InChI | InChI=1S/C31H32O2Se/c1-30(2,3)23-11-9-22(10-12-23)26-18-19-31(4,5)28-20-25(15-16-27(26)28)34-24-13-6-21(7-14-24)8-17-29(32)33/h6-18,20H,19H2,1-5H3,(H,32,33)/b17-8+ |
| InChIKey | LADWZLJSZOKPIN-CAOOACKPSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|