C28H26O — CID 140992150
1-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 140992150) has the molecular formula C28H26O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 140992150 |
| Molecular Formula | C28H26O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1ccc(C2=CCC(C)(C)c3cc(C(=O)C=Cc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C28H26O/c1-20-9-12-22(13-10-20)24-17-18-28(2,3)26-19-23(14-15-25(24)26)27(29)16-11-21-7-5-4-6-8-21/h4-17,19H,18H2,1-3H3 |
| InChIKey | KZDLDVKXICWIED-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|