C26H22O3S — CID 54528150
4-[3-(8,8-dimethyl-5-thiophen-2-yl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 54528150) has the molecular formula C26H22O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-[3-(8,8-dimethyl-5-thiophen-2-yl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-(8,8-dimethyl-5-thiophen-2-yl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54528150 |
| Molecular Formula | C26H22O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-[3-(8,8-dimethyl-5-thiophen-2-yl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CC1(C)CC=C(c2cccs2)c2ccc(C(=O)C=Cc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C26H22O3S/c1-26(2)14-13-21(24-4-3-15-30-24)20-11-10-19(16-22(20)26)23(27)12-7-17-5-8-18(9-6-17)25(28)29/h3-13,15-16H,14H2,1-2H3,(H,28,29) |
| InChIKey | YUOUDEXGOMBAIH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|