C29H26O3 — CID 54296652
4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 54296652) has the molecular formula C29H26O3 and a molecular weight of 422.52 g/mol. Its IUPAC name is 4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54296652 |
| Molecular Formula | C29H26O3 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-[3-[8,8-dimethyl-5-(4-methylphenyl)-7H-naphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | Cc1ccc(C2=CCC(C)(C)c3cc(C(=O)C=Cc4ccc(C(=O)O)cc4)ccc32)cc1 |
| InChI | InChI=1S/C29H26O3/c1-19-4-9-21(10-5-19)24-16-17-29(2,3)26-18-23(13-14-25(24)26)27(30)15-8-20-6-11-22(12-7-20)28(31)32/h4-16,18H,17H2,1-3H3,(H,31,32) |
| InChIKey | SBFXPLUUMAMXFA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|