C28H24O3 — CID 70347469
2-[3-(8,8-dimethyl-5-phenyl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 70347469) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[3-(8,8-dimethyl-5-phenyl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 2-[3-(8,8-dimethyl-5-phenyl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 70347469 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[3-(8,8-dimethyl-5-phenyl-7H-naphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CC1(C)CC=C(c2ccccc2)c2ccc(C(=O)C=Cc3ccccc3C(=O)O)cc21 |
| InChI | InChI=1S/C28H24O3/c1-28(2)17-16-22(19-8-4-3-5-9-19)24-14-12-21(18-25(24)28)26(29)15-13-20-10-6-7-11-23(20)27(30)31/h3-16,18H,17H2,1-2H3,(H,30,31) |
| InChIKey | BTWNYKXIKJLFIG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|