C23H20O3 — CID 175745581
(E)-1-(3,4-dimethoxyphenyl)-3-(2-phenylphenyl)prop-2-en-1-one (PubChem CID 175745581) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-(2-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-(2-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175745581 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-(2-phenylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccccc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H20O3/c1-25-22-15-13-19(16-23(22)26-2)21(24)14-12-18-10-6-7-11-20(18)17-8-4-3-5-9-17/h3-16H,1-2H3/b14-12+ |
| InChIKey | YVOVWFPTYTVSQD-WYMLVPIESA-N |
| XLogP | 5.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|