C24H21FO4 — CID 118725330
(E)-3-[2-(4-fluorophenyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 118725330) has the molecular formula C24H21FO4 and a molecular weight of 392.43 g/mol. Its IUPAC name is (E)-3-[2-(4-fluorophenyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-(4-fluorophenyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118725330 |
| Molecular Formula | C24H21FO4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (E)-3-[2-(4-fluorophenyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccccc2-c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H21FO4/c1-27-22-14-18(15-23(28-2)24(22)29-3)21(26)13-10-16-6-4-5-7-20(16)17-8-11-19(25)12-9-17/h4-15H,1-3H3/b13-10+ |
| InChIKey | URAADWHYCOKGGH-JLHYYAGUSA-N |
| XLogP | 5.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|